C17H25NO2 — CID 146847106
3-methyl-N-(10-methyl-8-oxoundeca-2,4-diynyl)butanamide (PubChem CID 146847106) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-methyl-N-(10-methyl-8-oxoundeca-2,4-diynyl)butanamide.
| Compound Name | 3-methyl-N-(10-methyl-8-oxoundeca-2,4-diynyl)butanamide |
|---|---|
| PubChem CID | 146847106 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-methyl-N-(10-methyl-8-oxoundeca-2,4-diynyl)butanamide |
| SMILES | CC(C)CC(=O)CCC#CC#CCNC(=O)CC(C)C |
| InChI | InChI=1S/C17H25NO2/c1-14(2)12-16(19)10-8-6-5-7-9-11-18-17(20)13-15(3)4/h14-15H,8,10-13H2,1-4H3,(H,18,20) |
| InChIKey | SHOYXIOWNSLCJN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|