C17H12ClF3IN3OS — CID 118043030
3-(5-chloro-2-ethylsulfanylanilino)-8-iodo-6-(trifluoromethyl)quinazolin-4-one (PubChem CID 118043030) has the molecular formula C17H12ClF3IN3OS and a molecular weight of 525.72 g/mol. Its IUPAC name is 3-(5-chloro-2-ethylsulfanylanilino)-8-iodo-6-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-(5-chloro-2-ethylsulfanylanilino)-8-iodo-6-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 118043030 |
| Molecular Formula | C17H12ClF3IN3OS |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 524.94 |
| IUPAC Name | 3-(5-chloro-2-ethylsulfanylanilino)-8-iodo-6-(trifluoromethyl)quinazolin-4-one |
| SMILES | CCSc1ccc(Cl)cc1Nn1cnc2c(I)cc(C(F)(F)F)cc2c1=O |
| InChI | InChI=1S/C17H12ClF3IN3OS/c1-2-27-14-4-3-10(18)7-13(14)24-25-8-23-15-11(16(25)26)5-9(6-12(15)22)17(19,20)21/h3-8,24H,2H2,1H3 |
| InChIKey | ABOVPSPAORDAOM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|