C16H12ClF3N4O3S — CID 122505218
3-[(2-chloro-5-ethylsulfonyl-4-pyridinyl)amino]-6-(trifluoromethyl)quinazolin-4-one (PubChem CID 122505218) has the molecular formula C16H12ClF3N4O3S and a molecular weight of 432.81 g/mol. Its IUPAC name is 3-[(2-chloro-5-ethylsulfonyl-4-pyridinyl)amino]-6-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-[(2-chloro-5-ethylsulfonyl-4-pyridinyl)amino]-6-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 122505218 |
| Molecular Formula | C16H12ClF3N4O3S |
| Molecular Weight | 432.81 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 3-[(2-chloro-5-ethylsulfonyl-4-pyridinyl)amino]-6-(trifluoromethyl)quinazolin-4-one |
| SMILES | CCS(=O)(=O)c1cnc(Cl)cc1Nn1cnc2ccc(C(F)(F)F)cc2c1=O |
| InChI | InChI=1S/C16H12ClF3N4O3S/c1-2-28(26,27)13-7-21-14(17)6-12(13)23-24-8-22-11-4-3-9(16(18,19)20)5-10(11)15(24)25/h3-8H,2H2,1H3,(H,21,23) |
| InChIKey | CYGNMAPXNCZSSC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.81 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|