C25H25ClFN7O2 — CID 118045223
4-[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl]-N-[(1S)-2-azido-1-(3-chlorophenyl)ethyl]-2-fluorobenzamide (PubChem CID 118045223) has the molecular formula C25H25ClFN7O2 and a molecular weight of 509.97 g/mol. Its IUPAC name is 4-[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl]-N-[(1S)-2-azido-1-(3-chlorophenyl)ethyl]-2-fluorobenzamide.
| Compound Name | 4-[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl]-N-[(1S)-2-azido-1-(3-chlorophenyl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 118045223 |
| Molecular Formula | C25H25ClFN7O2 |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 4-[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl]-N-[(1S)-2-azido-1-(3-chlorophenyl)ethyl]-2-fluorobenzamide |
| SMILES | [N-]=[N+]=NC[C@@H](NC(=O)c1ccc(-c2nc(C3CCC(O)CC3)cnc2N)cc1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H25ClFN7O2/c26-17-3-1-2-15(10-17)22(13-31-34-29)33-25(36)19-9-6-16(11-20(19)27)23-24(28)30-12-21(32-23)14-4-7-18(35)8-5-14/h1-3,6,9-12,14,18,22,35H,4-5,7-8,13H2,(H2,28,30)(H,33,36)/t14?,18?,22-/m1/s1 |
| InChIKey | JDNRTODMZQZZFJ-RMKQUTBESA-N |
| XLogP | 5.32 |
| TPSA | 149.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|