C13H30N4O — CID 118045347
2-[2-[(1-amino-2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol (PubChem CID 118045347) has the molecular formula C13H30N4O and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-[2-[(1-amino-2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol.
| Compound Name | 2-[2-[(1-amino-2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 118045347 |
| Molecular Formula | C13H30N4O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 2-[2-[(1-amino-2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol |
| SMILES | CC1(C)CC(NCCNCCO)CC(C)(C)N1N |
| InChI | InChI=1S/C13H30N4O/c1-12(2)9-11(10-13(3,4)17(12)14)16-6-5-15-7-8-18/h11,15-16,18H,5-10,14H2,1-4H3 |
| InChIKey | VTGOXHYWINXMRJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|