C18H19FN4O4 — CID 118045383
4-[3-amino-6-(1-methoxycarbonylpiperidin-3-yl)pyrazin-2-yl]-2-fluorobenzoic acid (PubChem CID 118045383) has the molecular formula C18H19FN4O4 and a molecular weight of 374.37 g/mol. Its IUPAC name is 4-[3-amino-6-(1-methoxycarbonylpiperidin-3-yl)pyrazin-2-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[3-amino-6-(1-methoxycarbonylpiperidin-3-yl)pyrazin-2-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 118045383 |
| Molecular Formula | C18H19FN4O4 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-[3-amino-6-(1-methoxycarbonylpiperidin-3-yl)pyrazin-2-yl]-2-fluorobenzoic acid |
| SMILES | COC(=O)N1CCCC(c2cnc(N)c(-c3ccc(C(=O)O)c(F)c3)n2)C1 |
| InChI | InChI=1S/C18H19FN4O4/c1-27-18(26)23-6-2-3-11(9-23)14-8-21-16(20)15(22-14)10-4-5-12(17(24)25)13(19)7-10/h4-5,7-8,11H,2-3,6,9H2,1H3,(H2,20,21)(H,24,25) |
| InChIKey | VEBBBIKNZLYMSL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |