C17H19FN4O3 — CID 144840337
4-[3-amino-6-[1-(methylamino)-5-oxopentan-2-yl]pyrazin-2-yl]-2-fluorobenzoic acid (PubChem CID 144840337) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is 4-[3-amino-6-[1-(methylamino)-5-oxopentan-2-yl]pyrazin-2-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[3-amino-6-[1-(methylamino)-5-oxopentan-2-yl]pyrazin-2-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 144840337 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-[3-amino-6-[1-(methylamino)-5-oxopentan-2-yl]pyrazin-2-yl]-2-fluorobenzoic acid |
| SMILES | CNCC(CCC=O)c1cnc(N)c(-c2ccc(C(=O)O)c(F)c2)n1 |
| InChI | InChI=1S/C17H19FN4O3/c1-20-8-11(3-2-6-23)14-9-21-16(19)15(22-14)10-4-5-12(17(24)25)13(18)7-10/h4-7,9,11,20H,2-3,8H2,1H3,(H2,19,21)(H,24,25) |
| InChIKey | DWYLOEOVNWDFEY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|