C17H18FN3O3 — CID 118045986
methyl 4-[3-amino-6-(oxan-4-yl)pyrazin-2-yl]-2-fluorobenzoate (PubChem CID 118045986) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is methyl 4-[3-amino-6-(oxan-4-yl)pyrazin-2-yl]-2-fluorobenzoate.
| Compound Name | methyl 4-[3-amino-6-(oxan-4-yl)pyrazin-2-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 118045986 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | methyl 4-[3-amino-6-(oxan-4-yl)pyrazin-2-yl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(-c2nc(C3CCOCC3)cnc2N)cc1F |
| InChI | InChI=1S/C17H18FN3O3/c1-23-17(22)12-3-2-11(8-13(12)18)15-16(19)20-9-14(21-15)10-4-6-24-7-5-10/h2-3,8-10H,4-7H2,1H3,(H2,19,20) |
| InChIKey | XXPYYPWSJAWUAG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |