C20H28FN3O3 — CID 144840536
cyclohexanol;ethane;methyl 4-(3-aminopyrazin-2-yl)-2-fluorobenzoate (PubChem CID 144840536) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is cyclohexanol;ethane;methyl 4-(3-aminopyrazin-2-yl)-2-fluorobenzoate.
| Compound Name | cyclohexanol;ethane;methyl 4-(3-aminopyrazin-2-yl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 144840536 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | cyclohexanol;ethane;methyl 4-(3-aminopyrazin-2-yl)-2-fluorobenzoate |
| SMILES | CC.COC(=O)c1ccc(-c2nccnc2N)cc1F.OC1CCCCC1 |
| InChI | InChI=1S/C12H10FN3O2.C6H12O.C2H6/c1-18-12(17)8-3-2-7(6-9(8)13)10-11(14)16-5-4-15-10;7-6-4-2-1-3-5-6;1-2/h2-6H,1H3,(H2,14,16);6-7H,1-5H2;1-2H3 |
| InChIKey | PZMUWFXTNXVVMU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |