C24H24FN3O3S — CID 118045524
4-[2-amino-5-(1,1-dioxothian-4-yl)-3-pyridinyl]-N-benzyl-2-fluorobenzamide (PubChem CID 118045524) has the molecular formula C24H24FN3O3S and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-[2-amino-5-(1,1-dioxothian-4-yl)-3-pyridinyl]-N-benzyl-2-fluorobenzamide.
| Compound Name | 4-[2-amino-5-(1,1-dioxothian-4-yl)-3-pyridinyl]-N-benzyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 118045524 |
| Molecular Formula | C24H24FN3O3S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 4-[2-amino-5-(1,1-dioxothian-4-yl)-3-pyridinyl]-N-benzyl-2-fluorobenzamide |
| SMILES | Nc1ncc(C2CCS(=O)(=O)CC2)cc1-c1ccc(C(=O)NCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C24H24FN3O3S/c25-22-13-18(6-7-20(22)24(29)28-14-16-4-2-1-3-5-16)21-12-19(15-27-23(21)26)17-8-10-32(30,31)11-9-17/h1-7,12-13,15,17H,8-11,14H2,(H2,26,27)(H,28,29) |
| InChIKey | PTAKWOCVJLFYDC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |