C22H26FN5O2 — CID 144840311
N-[(Z,2E)-4-amino-2-(aminomethylidene)but-3-enyl]-4-[2-amino-5-(oxan-4-yl)-3-pyridinyl]-2-fluorobenzamide (PubChem CID 144840311) has the molecular formula C22H26FN5O2 and a molecular weight of 411.48 g/mol. Its IUPAC name is N-[(Z,2E)-4-amino-2-(aminomethylidene)but-3-enyl]-4-[2-amino-5-(oxan-4-yl)-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | N-[(Z,2E)-4-amino-2-(aminomethylidene)but-3-enyl]-4-[2-amino-5-(oxan-4-yl)-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 144840311 |
| Molecular Formula | C22H26FN5O2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-[(Z,2E)-4-amino-2-(aminomethylidene)but-3-enyl]-4-[2-amino-5-(oxan-4-yl)-3-pyridinyl]-2-fluorobenzamide |
| SMILES | N/C=C\C(=C/N)CNC(=O)c1ccc(-c2cc(C3CCOCC3)cnc2N)cc1F |
| InChI | InChI=1S/C22H26FN5O2/c23-20-10-16(1-2-18(20)22(29)28-12-14(11-25)3-6-24)19-9-17(13-27-21(19)26)15-4-7-30-8-5-15/h1-3,6,9-11,13,15H,4-5,7-8,12,24-25H2,(H2,26,27)(H,28,29)/b6-3-,14-11+ |
| InChIKey | LLHFYAISWMOEBU-SPQCEJSXSA-N |
| XLogP | 2.41 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|