C24H25FN4O — CID 144840517
4-(2-amino-5-piperidin-4-yl-3-pyridinyl)-N-benzyl-2-fluorobenzamide (PubChem CID 144840517) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-(2-amino-5-piperidin-4-yl-3-pyridinyl)-N-benzyl-2-fluorobenzamide.
| Compound Name | 4-(2-amino-5-piperidin-4-yl-3-pyridinyl)-N-benzyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 144840517 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 4-(2-amino-5-piperidin-4-yl-3-pyridinyl)-N-benzyl-2-fluorobenzamide |
| SMILES | Nc1ncc(C2CCNCC2)cc1-c1ccc(C(=O)NCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C24H25FN4O/c25-22-13-18(6-7-20(22)24(30)29-14-16-4-2-1-3-5-16)21-12-19(15-28-23(21)26)17-8-10-27-11-9-17/h1-7,12-13,15,17,27H,8-11,14H2,(H2,26,28)(H,29,30) |
| InChIKey | AXZKTMAGDOCLNA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |