2,2,3,3,4,4-hexaaminohexanoic acid

C6H18N6O2 — CID 118047883

IUPAC2,2,3,3,4,4-hexaaminohexanoic acid
SMILESCCC(N)(N)C(N)(N)C(N)(N)C(=O)O
InChIInChI=1S/C6H18N6O2/c1-2-4(7,8)6(11,12)5(9,10)3(13)14/h2,7-12H2,1H3,(H,13,14)
InChIKeySRMJUSXGAMRMDL-UHFFFAOYSA-N
MW206.25 g/mol
LogP-3.68
Rot. Bonds4

About 2,2,3,3,4,4-hexaaminohexanoic acid

2,2,3,3,4,4-hexaaminohexanoic acid (PubChem CID 118047883) has the molecular formula C6H18N6O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexaaminohexanoic acid.

Molecular Properties

Compound Name2,2,3,3,4,4-hexaaminohexanoic acid
PubChem CID118047883
Molecular FormulaC6H18N6O2
Molecular Weight206.25 g/mol
Exact Mass206.15
IUPAC Name2,2,3,3,4,4-hexaaminohexanoic acid
SMILESCCC(N)(N)C(N)(N)C(N)(N)C(=O)O
InChIInChI=1S/C6H18N6O2/c1-2-4(7,8)6(11,12)5(9,10)3(13)14/h2,7-12H2,1H3,(H,13,14)
InChIKeySRMJUSXGAMRMDL-UHFFFAOYSA-N
XLogP-3.68
TPSA193.42 Ų
H-Bond Donors7
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500206.25
LogP ≤ 5-3.68
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2,2,3,3,4,4-hexaaminohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,3,3,4,4-hexaaminohexanoic acid?
The IUPAC name of 2,2,3,3,4,4-hexaaminohexanoic acid (CID 118047883) is 2,2,3,3,4,4-hexaaminohexanoic acid.
What is the SMILES notation for 2,2,3,3,4,4-hexaaminohexanoic acid?
The canonical SMILES for 2,2,3,3,4,4-hexaaminohexanoic acid is CCC(N)(N)C(N)(N)C(N)(N)C(=O)O.
What is the InChIKey of 2,2,3,3,4,4-hexaaminohexanoic acid?
The InChIKey is SRMJUSXGAMRMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N6O2/c1-2-4(7,8)6(11,12)5(9,10)3(13)14/h2,7-12H2,1H3,(H,13,14).
What are the key properties of 2,2,3,3,4,4-hexaaminohexanoic acid?
2,2,3,3,4,4-hexaaminohexanoic acid has a molecular weight of 206.25 g/mol, XLogP of -3.68, 4 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3,4,4-hexaaminohexanoic acid is sourced from PubChem (CID 118047883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).