C18H23N7O3 — CID 118048034
3-imidazol-1-yl-1-[3-(3-imidazol-1-ylpropanoyl)-5-prop-2-enoyl-1,3,5-triazinan-1-yl]propan-1-one (PubChem CID 118048034) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 3-imidazol-1-yl-1-[3-(3-imidazol-1-ylpropanoyl)-5-prop-2-enoyl-1,3,5-triazinan-1-yl]propan-1-one.
| Compound Name | 3-imidazol-1-yl-1-[3-(3-imidazol-1-ylpropanoyl)-5-prop-2-enoyl-1,3,5-triazinan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 118048034 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 3-imidazol-1-yl-1-[3-(3-imidazol-1-ylpropanoyl)-5-prop-2-enoyl-1,3,5-triazinan-1-yl]propan-1-one |
| SMILES | C=CC(=O)N1CN(C(=O)CCn2ccnc2)CN(C(=O)CCn2ccnc2)C1 |
| InChI | InChI=1S/C18H23N7O3/c1-2-16(26)23-13-24(17(27)3-7-21-9-5-19-11-21)15-25(14-23)18(28)4-8-22-10-6-20-12-22/h2,5-6,9-12H,1,3-4,7-8,13-15H2 |
| InChIKey | VMRHLDMBJHVJDS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 96.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|