C9H18OS — CID 11805246
(2S,3R)-5-methyl-3-(methylsulfanylmethyl)hex-4-en-2-ol (PubChem CID 11805246) has the molecular formula C9H18OS and a molecular weight of 174.31 g/mol. Its IUPAC name is (2S,3R)-5-methyl-3-(methylsulfanylmethyl)hex-4-en-2-ol.
| Compound Name | (2S,3R)-5-methyl-3-(methylsulfanylmethyl)hex-4-en-2-ol |
|---|---|
| PubChem CID | 11805246 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | (2S,3R)-5-methyl-3-(methylsulfanylmethyl)hex-4-en-2-ol |
| SMILES | CSCC(C=C(C)C)[C@H](C)O |
| InChI | InChI=1S/C9H18OS/c1-7(2)5-9(6-11-4)8(3)10/h5,8-10H,6H2,1-4H3/t8-,9?/m0/s1 |
| InChIKey | DBPAOIHRDPLGEZ-IENPIDJESA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|