C17H30OS — CID 171555104
(3Z,4Z,6Z)-3-butan-2-ylidene-5-methyl-1-methylsulfanyl-6-propan-2-ylocta-4,6-dien-2-ol (PubChem CID 171555104) has the molecular formula C17H30OS and a molecular weight of 282.49 g/mol. Its IUPAC name is (3Z,4Z,6Z)-3-butan-2-ylidene-5-methyl-1-methylsulfanyl-6-propan-2-ylocta-4,6-dien-2-ol.
| Compound Name | (3Z,4Z,6Z)-3-butan-2-ylidene-5-methyl-1-methylsulfanyl-6-propan-2-ylocta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 171555104 |
| Molecular Formula | C17H30OS |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (3Z,4Z,6Z)-3-butan-2-ylidene-5-methyl-1-methylsulfanyl-6-propan-2-ylocta-4,6-dien-2-ol |
| SMILES | C/C=C(C(\C)=C/C(=C(\C)CC)C(O)CSC)/C(C)C |
| InChI | InChI=1S/C17H30OS/c1-8-13(5)16(17(18)11-19-7)10-14(6)15(9-2)12(3)4/h9-10,12,17-18H,8,11H2,1-7H3/b14-10-,15-9-,16-13- |
| InChIKey | VJOLDZAOIQDAOM-CMZPPSKNSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|