C10H16O3 — CID 11805414
ethyl 2-hydroxy-2-methyl-4-methylidenecyclopentane-1-carboxylate (PubChem CID 11805414) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-methyl-4-methylidenecyclopentane-1-carboxylate.
| Compound Name | ethyl 2-hydroxy-2-methyl-4-methylidenecyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11805414 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | ethyl 2-hydroxy-2-methyl-4-methylidenecyclopentane-1-carboxylate |
| SMILES | C=C1CC(C(=O)OCC)C(C)(O)C1 |
| InChI | InChI=1S/C10H16O3/c1-4-13-9(11)8-5-7(2)6-10(8,3)12/h8,12H,2,4-6H2,1,3H3 |
| InChIKey | ZFNXWUOXTIROOY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|