C18H30O3 — CID 135072835
ethyl 2-[(1S)-1-hydroxy-1-[(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclopentyl]ethyl]pent-4-enoate (PubChem CID 135072835) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is ethyl 2-[(1S)-1-hydroxy-1-[(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclopentyl]ethyl]pent-4-enoate.
| Compound Name | ethyl 2-[(1S)-1-hydroxy-1-[(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclopentyl]ethyl]pent-4-enoate |
|---|---|
| PubChem CID | 135072835 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | ethyl 2-[(1S)-1-hydroxy-1-[(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclopentyl]ethyl]pent-4-enoate |
| SMILES | C=CCC(C(=O)OCC)[C@@](C)(O)[C@@H]1[C@H](C)CC[C@H]1C(=C)C |
| InChI | InChI=1S/C18H30O3/c1-7-9-15(17(19)21-8-2)18(6,20)16-13(5)10-11-14(16)12(3)4/h7,13-16,20H,1,3,8-11H2,2,4-6H3/t13-,14+,15?,16-,18-/m1/s1 |
| InChIKey | OZKAFZJSJDIGGY-BJLQQYENSA-N |
| XLogP | 3.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|