C16H24O3 — CID 129011730
methyl (1S,3aR,5S,6aR)-1-but-3-enyl-5-ethenyl-6a-hydroxy-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate (PubChem CID 129011730) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl (1S,3aR,5S,6aR)-1-but-3-enyl-5-ethenyl-6a-hydroxy-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate.
| Compound Name | methyl (1S,3aR,5S,6aR)-1-but-3-enyl-5-ethenyl-6a-hydroxy-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 129011730 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl (1S,3aR,5S,6aR)-1-but-3-enyl-5-ethenyl-6a-hydroxy-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate |
| SMILES | C=CCC[C@]1(C(=O)OC)CC[C@@H]2C[C@H](C=C)C[C@@]21O |
| InChI | InChI=1S/C16H24O3/c1-4-6-8-15(14(17)19-3)9-7-13-10-12(5-2)11-16(13,15)18/h4-5,12-13,18H,1-2,6-11H2,3H3/t12-,13+,15+,16+/m0/s1 |
| InChIKey | MNEJLBPADKCHJA-SJXGUFTOSA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|