C15H24O3 — CID 129011754
methyl (1S,3aR,5S,6aR)-1-but-3-enyl-6a-hydroxy-5-methyl-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate (PubChem CID 129011754) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is methyl (1S,3aR,5S,6aR)-1-but-3-enyl-6a-hydroxy-5-methyl-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate.
| Compound Name | methyl (1S,3aR,5S,6aR)-1-but-3-enyl-6a-hydroxy-5-methyl-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 129011754 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | methyl (1S,3aR,5S,6aR)-1-but-3-enyl-6a-hydroxy-5-methyl-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate |
| SMILES | C=CCC[C@]1(C(=O)OC)CC[C@@H]2C[C@H](C)C[C@@]21O |
| InChI | InChI=1S/C15H24O3/c1-4-5-7-14(13(16)18-3)8-6-12-9-11(2)10-15(12,14)17/h4,11-12,17H,1,5-10H2,2-3H3/t11-,12+,14+,15+/m0/s1 |
| InChIKey | BRTVMZHNMAHUDU-CTHBEMJXSA-N |
| XLogP | 2.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|