C19H32O3 — CID 129011735
methyl (1S,3aR,4S,5R,6aR)-4-ethyl-1-[(E)-hex-3-enyl]-6a-hydroxy-5-methyl-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate (PubChem CID 129011735) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is methyl (1S,3aR,4S,5R,6aR)-4-ethyl-1-[(E)-hex-3-enyl]-6a-hydroxy-5-methyl-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate.
| Compound Name | methyl (1S,3aR,4S,5R,6aR)-4-ethyl-1-[(E)-hex-3-enyl]-6a-hydroxy-5-methyl-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 129011735 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | methyl (1S,3aR,4S,5R,6aR)-4-ethyl-1-[(E)-hex-3-enyl]-6a-hydroxy-5-methyl-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate |
| SMILES | CC/C=C/CC[C@]1(C(=O)OC)CC[C@@H]2[C@@H](CC)[C@H](C)C[C@@]21O |
| InChI | InChI=1S/C19H32O3/c1-5-7-8-9-11-18(17(20)22-4)12-10-16-15(6-2)14(3)13-19(16,18)21/h7-8,14-16,21H,5-6,9-13H2,1-4H3/b8-7+/t14-,15+,16-,18-,19-/m1/s1 |
| InChIKey | VXIDRCYAVSIVDQ-LBUBNKLJSA-N |
| XLogP | 4.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|