C31H31N5O4S — CID 118055473
4-[4-[[(6aS)-2-methyl-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-N-(1-benzothiophen-5-yl)-1-methylpyrrole-2-carboxamide (PubChem CID 118055473) has the molecular formula C31H31N5O4S and a molecular weight of 569.69 g/mol. Its IUPAC name is 4-[4-[[(6aS)-2-methyl-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-N-(1-benzothiophen-5-yl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[4-[[(6aS)-2-methyl-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-N-(1-benzothiophen-5-yl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118055473 |
| Molecular Formula | C31H31N5O4S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | 4-[4-[[(6aS)-2-methyl-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-N-(1-benzothiophen-5-yl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1cc2c(cc1OCCCC(=O)Nc1cc(C(=O)Nc3ccc4sccc4c3)n(C)c1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C31H31N5O4S/c1-19-13-24-25(32-17-23-5-3-10-36(23)31(24)39)16-27(19)40-11-4-6-29(37)33-22-15-26(35(2)18-22)30(38)34-21-7-8-28-20(14-21)9-12-41-28/h7-9,12-18,23H,3-6,10-11H2,1-2H3,(H,33,37)(H,34,38)/t23-/m0/s1 |
| InChIKey | STXGVCKKDINHBZ-QHCPKHFHSA-N |
| XLogP | 5.92 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|