C36H40N6O7 — CID 153489245
N-[2-(diethylcarbamoyl)-1-benzofuran-5-yl]-4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylpyrrole-2-carboxamide (PubChem CID 153489245) has the molecular formula C36H40N6O7 and a molecular weight of 668.75 g/mol. Its IUPAC name is N-[2-(diethylcarbamoyl)-1-benzofuran-5-yl]-4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-(diethylcarbamoyl)-1-benzofuran-5-yl]-4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 153489245 |
| Molecular Formula | C36H40N6O7 |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | N-[2-(diethylcarbamoyl)-1-benzofuran-5-yl]-4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylpyrrole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2cc(NC(=O)c3cc(NC(=O)CCCOc4cc5c(cc4OC)C(=O)N4CCCC4C=N5)cn3C)ccc2o1 |
| InChI | InChI=1S/C36H40N6O7/c1-5-41(6-2)36(46)32-16-22-15-23(11-12-29(22)49-32)39-34(44)28-17-24(21-40(28)3)38-33(43)10-8-14-48-31-19-27-26(18-30(31)47-4)35(45)42-13-7-9-25(42)20-37-27/h11-12,15-21,25H,5-10,13-14H2,1-4H3,(H,38,43)(H,39,44) |
| InChIKey | FKHPILWGNCFRQD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|