C34H38N6O6 — CID 137356750
4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butylamino]-N-[2-(dimethylcarbamoyl)-1-benzofuran-5-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 137356750) has the molecular formula C34H38N6O6 and a molecular weight of 626.71 g/mol. Its IUPAC name is 4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butylamino]-N-[2-(dimethylcarbamoyl)-1-benzofuran-5-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butylamino]-N-[2-(dimethylcarbamoyl)-1-benzofuran-5-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 137356750 |
| Molecular Formula | C34H38N6O6 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butylamino]-N-[2-(dimethylcarbamoyl)-1-benzofuran-5-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | COc1cc2c(cc1OCCCCNc1cc(C(=O)Nc3ccc4oc(C(=O)N(C)C)cc4c3)n(C)c1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C34H38N6O6/c1-38(2)34(43)31-15-21-14-22(9-10-28(21)46-31)37-32(41)27-16-23(20-39(27)3)35-11-5-6-13-45-30-18-26-25(17-29(30)44-4)33(42)40-12-7-8-24(40)19-36-26/h9-10,14-20,24,35H,5-8,11-13H2,1-4H3,(H,37,41)/t24-/m0/s1 |
| InChIKey | JPZCWRKLZKRTMR-DEOSSOPVSA-N |
| XLogP | 5.33 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|