C35H38N6O5 — CID 162489081
4-[4-[[(6aS)-2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methyl-N-[4-(5-methyl-1H-pyrrol-3-yl)phenyl]pyrrole-2-carboxamide (PubChem CID 162489081) has the molecular formula C35H38N6O5 and a molecular weight of 622.73 g/mol. Its IUPAC name is 4-[4-[[(6aS)-2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methyl-N-[4-(5-methyl-1H-pyrrol-3-yl)phenyl]pyrrole-2-carboxamide.
| Compound Name | 4-[4-[[(6aS)-2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methyl-N-[4-(5-methyl-1H-pyrrol-3-yl)phenyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162489081 |
| Molecular Formula | C35H38N6O5 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | 4-[4-[[(6aS)-2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methyl-N-[4-(5-methyl-1H-pyrrol-3-yl)phenyl]pyrrole-2-carboxamide |
| SMILES | COc1cc2c(cc1OCCCC(=O)Nc1cc(C(=O)Nc3ccc(-c4c[nH]c(C)c4)cc3)n(C)c1)N=C[C@@H]1CCCCN1C2=O |
| InChI | InChI=1S/C35H38N6O5/c1-22-15-24(19-36-22)23-9-11-25(12-10-23)39-34(43)30-16-26(21-40(30)2)38-33(42)8-6-14-46-32-18-29-28(17-31(32)45-3)35(44)41-13-5-4-7-27(41)20-37-29/h9-12,15-21,27,36H,4-8,13-14H2,1-3H3,(H,38,42)(H,39,43)/t27-/m0/s1 |
| InChIKey | AVGXUIDHYHSFJY-MHZLTWQESA-N |
| XLogP | 6.10 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|