C36H38N6O7 — CID 167113270
methyl 4-[4-[[4-[4-[(2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]phenyl]-1H-pyrrole-2-carboxylate (PubChem CID 167113270) has the molecular formula C36H38N6O7 and a molecular weight of 666.74 g/mol. Its IUPAC name is methyl 4-[4-[[4-[4-[(2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]phenyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[4-[[4-[4-[(2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]phenyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 167113270 |
| Molecular Formula | C36H38N6O7 |
| Molecular Weight | 666.74 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | methyl 4-[4-[[4-[4-[(2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]phenyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(NC(=O)c3cc(NC(=O)CCCOc4cc5c(cc4OC)C(=O)N4CCCCC4C=N5)cn3C)cc2)c[nH]1 |
| InChI | InChI=1S/C36H38N6O7/c1-41-21-25(16-30(41)34(44)40-24-11-9-22(10-12-24)23-15-29(37-19-23)36(46)48-3)39-33(43)8-6-14-49-32-18-28-27(17-31(32)47-2)35(45)42-13-5-4-7-26(42)20-38-28/h9-12,15-21,26,37H,4-8,13-14H2,1-3H3,(H,39,43)(H,40,44) |
| InChIKey | PQYVZOSYTTZVHS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|