C37H44N6O7 — CID 129237096
N-[2-(diethylcarbamoyl)-1-benzofuran-5-yl]-4-[4-[4-formyl-2-methoxy-5-[(1-methylpyrrolidin-2-yl)methylideneamino]phenoxy]butanoylamino]-1-methylpyrrole-2-carboxamide (PubChem CID 129237096) has the molecular formula C37H44N6O7 and a molecular weight of 684.79 g/mol. Its IUPAC name is N-[2-(diethylcarbamoyl)-1-benzofuran-5-yl]-4-[4-[4-formyl-2-methoxy-5-[(1-methylpyrrolidin-2-yl)methylideneamino]phenoxy]butanoylamino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-(diethylcarbamoyl)-1-benzofuran-5-yl]-4-[4-[4-formyl-2-methoxy-5-[(1-methylpyrrolidin-2-yl)methylideneamino]phenoxy]butanoylamino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 129237096 |
| Molecular Formula | C37H44N6O7 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | N-[2-(diethylcarbamoyl)-1-benzofuran-5-yl]-4-[4-[4-formyl-2-methoxy-5-[(1-methylpyrrolidin-2-yl)methylideneamino]phenoxy]butanoylamino]-1-methylpyrrole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2cc(NC(=O)c3cc(NC(=O)CCCOc4cc(/N=C/C5CCCN5C)c(C=O)cc4OC)cn3C)ccc2o1 |
| InChI | InChI=1S/C37H44N6O7/c1-6-43(7-2)37(47)34-17-24-16-26(12-13-31(24)50-34)40-36(46)30-19-27(22-42(30)4)39-35(45)11-9-15-49-33-20-29(25(23-44)18-32(33)48-5)38-21-28-10-8-14-41(28)3/h12-13,16-23,28H,6-11,14-15H2,1-5H3,(H,39,45)(H,40,46)/b38-21+ |
| InChIKey | AOPNFJMSLZROIR-BBUXEPKYSA-N |
| XLogP | 5.92 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|