C18H26ClNO2 — CID 118058024
1-[3-[3-chloro-4-(oxan-4-yloxy)phenyl]propyl]pyrrolidine (PubChem CID 118058024) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is 1-[3-[3-chloro-4-(oxan-4-yloxy)phenyl]propyl]pyrrolidine.
| Compound Name | 1-[3-[3-chloro-4-(oxan-4-yloxy)phenyl]propyl]pyrrolidine |
|---|---|
| PubChem CID | 118058024 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-[3-[3-chloro-4-(oxan-4-yloxy)phenyl]propyl]pyrrolidine |
| SMILES | Clc1cc(CCCN2CCCC2)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C18H26ClNO2/c19-17-14-15(4-3-11-20-9-1-2-10-20)5-6-18(17)22-16-7-12-21-13-8-16/h5-6,14,16H,1-4,7-13H2 |
| InChIKey | QBQRWBMWDGLDPQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |