C34H39ClN4O3 — CID 144811505
1-[3-(3-chloro-4-cyclopropyloxyphenyl)propyl]pyrrolidine;2-oxo-2-[4-(1-propan-2-ylindazol-6-yl)phenyl]acetamide (PubChem CID 144811505) has the molecular formula C34H39ClN4O3 and a molecular weight of 587.16 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-cyclopropyloxyphenyl)propyl]pyrrolidine;2-oxo-2-[4-(1-propan-2-ylindazol-6-yl)phenyl]acetamide.
| Compound Name | 1-[3-(3-chloro-4-cyclopropyloxyphenyl)propyl]pyrrolidine;2-oxo-2-[4-(1-propan-2-ylindazol-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 144811505 |
| Molecular Formula | C34H39ClN4O3 |
| Molecular Weight | 587.16 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | 1-[3-(3-chloro-4-cyclopropyloxyphenyl)propyl]pyrrolidine;2-oxo-2-[4-(1-propan-2-ylindazol-6-yl)phenyl]acetamide |
| SMILES | CC(C)n1ncc2ccc(-c3ccc(C(=O)C(N)=O)cc3)cc21.Clc1cc(CCCN2CCCC2)ccc1OC1CC1 |
| InChI | InChI=1S/C18H17N3O2.C16H22ClNO/c1-11(2)21-16-9-14(7-8-15(16)10-20-21)12-3-5-13(6-4-12)17(22)18(19)23;17-15-12-13(4-3-11-18-9-1-2-10-18)5-8-16(15)19-14-6-7-14/h3-11H,1-2H3,(H2,19,23);5,8,12,14H,1-4,6-7,9-11H2 |
| InChIKey | SECJGGQYVGAMOU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.16 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|