C26H30ClN5O3 — CID 144811873
1-[3-(3-chloro-4-cyclopropyloxyphenyl)propyl]pyrrolidine;2-oxo-2-[4-(triazol-2-yl)phenyl]acetamide (PubChem CID 144811873) has the molecular formula C26H30ClN5O3 and a molecular weight of 496.01 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-cyclopropyloxyphenyl)propyl]pyrrolidine;2-oxo-2-[4-(triazol-2-yl)phenyl]acetamide.
| Compound Name | 1-[3-(3-chloro-4-cyclopropyloxyphenyl)propyl]pyrrolidine;2-oxo-2-[4-(triazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 144811873 |
| Molecular Formula | C26H30ClN5O3 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 1-[3-(3-chloro-4-cyclopropyloxyphenyl)propyl]pyrrolidine;2-oxo-2-[4-(triazol-2-yl)phenyl]acetamide |
| SMILES | Clc1cc(CCCN2CCCC2)ccc1OC1CC1.NC(=O)C(=O)c1ccc(-n2nccn2)cc1 |
| InChI | InChI=1S/C16H22ClNO.C10H8N4O2/c17-15-12-13(4-3-11-18-9-1-2-10-18)5-8-16(15)19-14-6-7-14;11-10(16)9(15)7-1-3-8(4-2-7)14-12-5-6-13-14/h5,8,12,14H,1-4,6-7,9-11H2;1-6H,(H2,11,16) |
| InChIKey | VKHVDTHHNDQNQC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|