C21H24ClNO7S — CID 118058117
[(2R,3R)-3-(3-chloro-4-cyclopropyloxyphenyl)-3-hydroxy-2-(phenylmethoxycarbonylamino)propyl] methanesulfonate (PubChem CID 118058117) has the molecular formula C21H24ClNO7S and a molecular weight of 469.94 g/mol. Its IUPAC name is [(2R,3R)-3-(3-chloro-4-cyclopropyloxyphenyl)-3-hydroxy-2-(phenylmethoxycarbonylamino)propyl] methanesulfonate.
| Compound Name | [(2R,3R)-3-(3-chloro-4-cyclopropyloxyphenyl)-3-hydroxy-2-(phenylmethoxycarbonylamino)propyl] methanesulfonate |
|---|---|
| PubChem CID | 118058117 |
| Molecular Formula | C21H24ClNO7S |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | [(2R,3R)-3-(3-chloro-4-cyclopropyloxyphenyl)-3-hydroxy-2-(phenylmethoxycarbonylamino)propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H](NC(=O)OCc1ccccc1)[C@H](O)c1ccc(OC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H24ClNO7S/c1-31(26,27)29-13-18(23-21(25)28-12-14-5-3-2-4-6-14)20(24)15-7-10-19(17(22)11-15)30-16-8-9-16/h2-7,10-11,16,18,20,24H,8-9,12-13H2,1H3,(H,23,25)/t18-,20-/m1/s1 |
| InChIKey | YQEKQDYJPJVJIE-UYAOXDASSA-N |
| XLogP | 3.19 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|