C13H22O2 — CID 11805969
(1S,2S,4aS,8R,8aR)-8-(2-hydroxyethyl)-2-methyl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-ol (PubChem CID 11805969) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (1S,2S,4aS,8R,8aR)-8-(2-hydroxyethyl)-2-methyl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-ol.
| Compound Name | (1S,2S,4aS,8R,8aR)-8-(2-hydroxyethyl)-2-methyl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11805969 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (1S,2S,4aS,8R,8aR)-8-(2-hydroxyethyl)-2-methyl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-ol |
| SMILES | C[C@H]1CC[C@H]2CC=C[C@@H](CCO)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C13H22O2/c1-9-5-6-10-3-2-4-11(7-8-14)12(10)13(9)15/h2,4,9-15H,3,5-8H2,1H3/t9-,10+,11-,12+,13-/m0/s1 |
| InChIKey | CHLYZQKPQDKHEY-OFTGVCEQSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|