C24H23N5O3S — CID 118062272
5-[[4-[(2-hydroxyethylamino)methyl]benzoyl]amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 118062272) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is 5-[[4-[(2-hydroxyethylamino)methyl]benzoyl]amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-[[4-[(2-hydroxyethylamino)methyl]benzoyl]amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118062272 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 5-[[4-[(2-hydroxyethylamino)methyl]benzoyl]amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1nc(Nc2ccc3ccccc3c2)sc1NC(=O)c1ccc(CNCCO)cc1 |
| InChI | InChI=1S/C24H23N5O3S/c25-21(31)20-23(29-22(32)17-7-5-15(6-8-17)14-26-11-12-30)33-24(28-20)27-19-10-9-16-3-1-2-4-18(16)13-19/h1-10,13,26,30H,11-12,14H2,(H2,25,31)(H,27,28)(H,29,32) |
| InChIKey | MRRFDSXTQKJXMB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|