C22H23N5O3S — CID 118061310
5-[6-(2-hydroxyethylamino)hex-2-ynoylamino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 118061310) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 5-[6-(2-hydroxyethylamino)hex-2-ynoylamino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-[6-(2-hydroxyethylamino)hex-2-ynoylamino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118061310 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 5-[6-(2-hydroxyethylamino)hex-2-ynoylamino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1nc(Nc2ccc3ccccc3c2)sc1NC(=O)C#CCCCNCCO |
| InChI | InChI=1S/C22H23N5O3S/c23-20(30)19-21(26-18(29)8-2-1-5-11-24-12-13-28)31-22(27-19)25-17-10-9-15-6-3-4-7-16(15)14-17/h3-4,6-7,9-10,14,24,28H,1,5,11-13H2,(H2,23,30)(H,25,27)(H,26,29) |
| InChIKey | ZULOYTPCXKXMCK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|