C17H13N3O2S — CID 118061294
4-hydroxy-N-[2-(naphthalen-2-ylamino)-1,3-thiazol-5-yl]but-2-ynamide (PubChem CID 118061294) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 4-hydroxy-N-[2-(naphthalen-2-ylamino)-1,3-thiazol-5-yl]but-2-ynamide.
| Compound Name | 4-hydroxy-N-[2-(naphthalen-2-ylamino)-1,3-thiazol-5-yl]but-2-ynamide |
|---|---|
| PubChem CID | 118061294 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-hydroxy-N-[2-(naphthalen-2-ylamino)-1,3-thiazol-5-yl]but-2-ynamide |
| SMILES | O=C(C#CCO)Nc1cnc(Nc2ccc3ccccc3c2)s1 |
| InChI | InChI=1S/C17H13N3O2S/c21-9-3-6-15(22)20-16-11-18-17(23-16)19-14-8-7-12-4-1-2-5-13(12)10-14/h1-2,4-5,7-8,10-11,21H,9H2,(H,18,19)(H,20,22) |
| InChIKey | WHZYJWVHEVBMPY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|