C18H15ClN4O2S — CID 118062264
5-[[(Z)-3-chlorobut-2-enoyl]amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 118062264) has the molecular formula C18H15ClN4O2S and a molecular weight of 386.86 g/mol. Its IUPAC name is 5-[[(Z)-3-chlorobut-2-enoyl]amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-[[(Z)-3-chlorobut-2-enoyl]amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118062264 |
| Molecular Formula | C18H15ClN4O2S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 5-[[(Z)-3-chlorobut-2-enoyl]amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | C/C(Cl)=C/C(=O)Nc1sc(Nc2ccc3ccccc3c2)nc1C(N)=O |
| InChI | InChI=1S/C18H15ClN4O2S/c1-10(19)8-14(24)22-17-15(16(20)25)23-18(26-17)21-13-7-6-11-4-2-3-5-12(11)9-13/h2-9H,1H3,(H2,20,25)(H,21,23)(H,22,24)/b10-8- |
| InChIKey | HYUYYTPMTLZMQG-NTMALXAHSA-N |
| XLogP | 4.22 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|