C19H19BrN4O2S — CID 118061542
5-(5-bromopentanoylamino)-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 118061542) has the molecular formula C19H19BrN4O2S and a molecular weight of 447.36 g/mol. Its IUPAC name is 5-(5-bromopentanoylamino)-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-(5-bromopentanoylamino)-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118061542 |
| Molecular Formula | C19H19BrN4O2S |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 5-(5-bromopentanoylamino)-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1nc(Nc2ccc3ccccc3c2)sc1NC(=O)CCCCBr |
| InChI | InChI=1S/C19H19BrN4O2S/c20-10-4-3-7-15(25)23-18-16(17(21)26)24-19(27-18)22-14-9-8-12-5-1-2-6-13(12)11-14/h1-2,5-6,8-9,11H,3-4,7,10H2,(H2,21,26)(H,22,24)(H,23,25) |
| InChIKey | PZJGTYHGUILTKG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|