C14H22O2 — CID 11806278
(3R,3aR,9aR)-3,5,5-trimethyl-1,2,3,3a,6,7,9,9a-octahydrocyclopenta[8]annulene-4,8-dione (PubChem CID 11806278) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3R,3aR,9aR)-3,5,5-trimethyl-1,2,3,3a,6,7,9,9a-octahydrocyclopenta[8]annulene-4,8-dione.
| Compound Name | (3R,3aR,9aR)-3,5,5-trimethyl-1,2,3,3a,6,7,9,9a-octahydrocyclopenta[8]annulene-4,8-dione |
|---|---|
| PubChem CID | 11806278 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3R,3aR,9aR)-3,5,5-trimethyl-1,2,3,3a,6,7,9,9a-octahydrocyclopenta[8]annulene-4,8-dione |
| SMILES | C[C@@H]1CC[C@@H]2CC(=O)CCC(C)(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C14H22O2/c1-9-4-5-10-8-11(15)6-7-14(2,3)13(16)12(9)10/h9-10,12H,4-8H2,1-3H3/t9-,10-,12-/m1/s1 |
| InChIKey | KMYPNRIMGLPEFP-CKYFFXLPSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |