C24H23N7O4S — CID 118063352
N-[3-[4-amino-1-[2-(N-ethenylsulfonylanilino)ethyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-hydroxyphenyl]prop-2-enamide (PubChem CID 118063352) has the molecular formula C24H23N7O4S and a molecular weight of 505.56 g/mol. Its IUPAC name is N-[3-[4-amino-1-[2-(N-ethenylsulfonylanilino)ethyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-hydroxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[4-amino-1-[2-(N-ethenylsulfonylanilino)ethyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-hydroxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118063352 |
| Molecular Formula | C24H23N7O4S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[3-[4-amino-1-[2-(N-ethenylsulfonylanilino)ethyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-hydroxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(O)cc(-c2nn(CCN(c3ccccc3)S(=O)(=O)C=C)c3ncnc(N)c23)c1 |
| InChI | InChI=1S/C24H23N7O4S/c1-3-20(33)28-17-12-16(13-19(32)14-17)22-21-23(25)26-15-27-24(21)30(29-22)10-11-31(36(34,35)4-2)18-8-6-5-7-9-18/h3-9,12-15,32H,1-2,10-11H2,(H,28,33)(H2,25,26,27) |
| InChIKey | VMLNCDUSIZSOIB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 156.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|