C28H24ClN3O8S2 — CID 118064608
ethyl 3-[[3-chloro-2-[(2-nitrophenyl)disulfanyl]phenyl]methyl]-1-(3,4-dimethoxyphenyl)-2,4-dioxopyrimidine-5-carboxylate (PubChem CID 118064608) has the molecular formula C28H24ClN3O8S2 and a molecular weight of 630.10 g/mol. Its IUPAC name is ethyl 3-[[3-chloro-2-[(2-nitrophenyl)disulfanyl]phenyl]methyl]-1-(3,4-dimethoxyphenyl)-2,4-dioxopyrimidine-5-carboxylate.
| Compound Name | ethyl 3-[[3-chloro-2-[(2-nitrophenyl)disulfanyl]phenyl]methyl]-1-(3,4-dimethoxyphenyl)-2,4-dioxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 118064608 |
| Molecular Formula | C28H24ClN3O8S2 |
| Molecular Weight | 630.10 g/mol |
| Exact Mass | 629.07 |
| IUPAC Name | ethyl 3-[[3-chloro-2-[(2-nitrophenyl)disulfanyl]phenyl]methyl]-1-(3,4-dimethoxyphenyl)-2,4-dioxopyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(OC)c(OC)c2)c(=O)n(Cc2cccc(Cl)c2SSc2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C28H24ClN3O8S2/c1-4-40-27(34)19-16-30(18-12-13-22(38-2)23(14-18)39-3)28(35)31(26(19)33)15-17-8-7-9-20(29)25(17)42-41-24-11-6-5-10-21(24)32(36)37/h5-14,16H,4,15H2,1-3H3 |
| InChIKey | MTZCJCPJYDOENS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 131.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.10 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|