C16H12N4O5S2 — CID 56618142
ethyl 9-[(2-nitrophenyl)disulfanyl]-4-oxopyrazino[1,2-a]pyrimidine-3-carboxylate (PubChem CID 56618142) has the molecular formula C16H12N4O5S2 and a molecular weight of 404.43 g/mol. Its IUPAC name is ethyl 9-[(2-nitrophenyl)disulfanyl]-4-oxopyrazino[1,2-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 9-[(2-nitrophenyl)disulfanyl]-4-oxopyrazino[1,2-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 56618142 |
| Molecular Formula | C16H12N4O5S2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | ethyl 9-[(2-nitrophenyl)disulfanyl]-4-oxopyrazino[1,2-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(SSc3ccccc3[N+](=O)[O-])nccn2c1=O |
| InChI | InChI=1S/C16H12N4O5S2/c1-2-25-16(22)10-9-18-13-14(17-7-8-19(13)15(10)21)27-26-12-6-4-3-5-11(12)20(23)24/h3-9H,2H2,1H3 |
| InChIKey | PSESYVCAKPORIP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 116.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|