C28H24N4O8S — CID 20559303
diethyl 5-[[4-(2-nitrophenyl)sulfanyl-3-oxo-2-phenyl-1H-pyrazol-5-yl]carbamoyl]benzene-1,3-dicarboxylate (PubChem CID 20559303) has the molecular formula C28H24N4O8S and a molecular weight of 576.59 g/mol. Its IUPAC name is diethyl 5-[[4-(2-nitrophenyl)sulfanyl-3-oxo-2-phenyl-1H-pyrazol-5-yl]carbamoyl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[4-(2-nitrophenyl)sulfanyl-3-oxo-2-phenyl-1H-pyrazol-5-yl]carbamoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 20559303 |
| Molecular Formula | C28H24N4O8S |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | diethyl 5-[[4-(2-nitrophenyl)sulfanyl-3-oxo-2-phenyl-1H-pyrazol-5-yl]carbamoyl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2[nH]n(-c3ccccc3)c(=O)c2Sc2ccccc2[N+](=O)[O-])cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C28H24N4O8S/c1-3-39-27(35)18-14-17(15-19(16-18)28(36)40-4-2)25(33)29-24-23(41-22-13-9-8-12-21(22)32(37)38)26(34)31(30-24)20-10-6-5-7-11-20/h5-16,30H,3-4H2,1-2H3,(H,29,33) |
| InChIKey | KRIXTGIXYOMCDN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 162.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|