C28H43N5O5 — CID 118066516
(3S)-3-[[(2S)-2-[[(2S)-2-[amino(benzoyl)amino]-3,3-dimethylbutanoyl]amino]propanoyl]amino]-N-cyclohexyl-4-methyl-2-oxopentanamide (PubChem CID 118066516) has the molecular formula C28H43N5O5 and a molecular weight of 529.68 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-2-[amino(benzoyl)amino]-3,3-dimethylbutanoyl]amino]propanoyl]amino]-N-cyclohexyl-4-methyl-2-oxopentanamide.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-2-[amino(benzoyl)amino]-3,3-dimethylbutanoyl]amino]propanoyl]amino]-N-cyclohexyl-4-methyl-2-oxopentanamide |
|---|---|
| PubChem CID | 118066516 |
| Molecular Formula | C28H43N5O5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-[amino(benzoyl)amino]-3,3-dimethylbutanoyl]amino]propanoyl]amino]-N-cyclohexyl-4-methyl-2-oxopentanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](N(N)C(=O)c1ccccc1)C(C)(C)C)C(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H43N5O5/c1-17(2)21(22(34)25(36)31-20-15-11-8-12-16-20)32-24(35)18(3)30-26(37)23(28(4,5)6)33(29)27(38)19-13-9-7-10-14-19/h7,9-10,13-14,17-18,20-21,23H,8,11-12,15-16,29H2,1-6H3,(H,30,37)(H,31,36)(H,32,35)/t18-,21-,23+/m0/s1 |
| InChIKey | PJPUFHMRBPGVSO-AVCGJXAMSA-N |
| XLogP | 2.08 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|