C33H29N3O3 — CID 118069587
2-[3-[6-[(Z)-2-amino-4-oxopent-2-en-3-yl]-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]phenyl]acetic acid (PubChem CID 118069587) has the molecular formula C33H29N3O3 and a molecular weight of 515.61 g/mol. Its IUPAC name is 2-[3-[6-[(Z)-2-amino-4-oxopent-2-en-3-yl]-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[6-[(Z)-2-amino-4-oxopent-2-en-3-yl]-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 118069587 |
| Molecular Formula | C33H29N3O3 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-[3-[6-[(Z)-2-amino-4-oxopent-2-en-3-yl]-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]phenyl]acetic acid |
| SMILES | CC(=O)/C(=C(/C)N)c1ccc2c(-c3cccc(CC(=O)O)c3)cn(C(c3ccccc3)c3ccccn3)c2c1 |
| InChI | InChI=1S/C33H29N3O3/c1-21(34)32(22(2)37)26-14-15-27-28(25-12-8-9-23(17-25)18-31(38)39)20-36(30(27)19-26)33(24-10-4-3-5-11-24)29-13-6-7-16-35-29/h3-17,19-20,33H,18,34H2,1-2H3,(H,38,39)/b32-21+ |
| InChIKey | YJXGOWLYVJVOFY-RUMWWMSVSA-N |
| XLogP | 6.25 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|