C32H26FN3O3 — CID 123440160
3-fluoro-4-[6-(2-imino-4-oxopentan-3-yl)-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]benzoic acid (PubChem CID 123440160) has the molecular formula C32H26FN3O3 and a molecular weight of 519.58 g/mol. Its IUPAC name is 3-fluoro-4-[6-(2-imino-4-oxopentan-3-yl)-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]benzoic acid.
| Compound Name | 3-fluoro-4-[6-(2-imino-4-oxopentan-3-yl)-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 123440160 |
| Molecular Formula | C32H26FN3O3 |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 3-fluoro-4-[6-(2-imino-4-oxopentan-3-yl)-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]benzoic acid |
| SMILES | [H]/N=C(\C)C(C(C)=O)c1ccc2c(-c3ccc(C(=O)O)cc3F)cn(C(c3ccccc3)c3ccccn3)c2c1 |
| InChI | InChI=1S/C32H26FN3O3/c1-19(34)30(20(2)37)22-11-14-25-26(24-13-12-23(32(38)39)16-27(24)33)18-36(29(25)17-22)31(21-8-4-3-5-9-21)28-10-6-7-15-35-28/h3-18,30-31,34H,1-2H3,(H,38,39)/b34-19+ |
| InChIKey | WMXQJOAFLHNSFK-ALQBTCKLSA-N |
| XLogP | 6.89 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|