C33H29N3O3 — CID 123306817
4-[6-(2-imino-4-oxopentan-3-yl)-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]-2-methylbenzoic acid (PubChem CID 123306817) has the molecular formula C33H29N3O3 and a molecular weight of 515.61 g/mol. Its IUPAC name is 4-[6-(2-imino-4-oxopentan-3-yl)-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]-2-methylbenzoic acid.
| Compound Name | 4-[6-(2-imino-4-oxopentan-3-yl)-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 123306817 |
| Molecular Formula | C33H29N3O3 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 4-[6-(2-imino-4-oxopentan-3-yl)-1-[phenyl(pyridin-2-yl)methyl]indol-3-yl]-2-methylbenzoic acid |
| SMILES | [H]/N=C(\C)C(C(C)=O)c1ccc2c(-c3ccc(C(=O)O)c(C)c3)cn(C(c3ccccc3)c3ccccn3)c2c1 |
| InChI | InChI=1S/C33H29N3O3/c1-20-17-24(12-14-26(20)33(38)39)28-19-36(30-18-25(13-15-27(28)30)31(21(2)34)22(3)37)32(23-9-5-4-6-10-23)29-11-7-8-16-35-29/h4-19,31-32,34H,1-3H3,(H,38,39)/b34-21+ |
| InChIKey | CHOJEFPSCZPJAK-KEIPNQJHSA-N |
| XLogP | 7.06 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|