C21H16N2O4 — CID 118071965
[1-(4-hydroxyphenyl)-2-phenylindol-3-yl] N-hydroxycarbamate (PubChem CID 118071965) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is [1-(4-hydroxyphenyl)-2-phenylindol-3-yl] N-hydroxycarbamate.
| Compound Name | [1-(4-hydroxyphenyl)-2-phenylindol-3-yl] N-hydroxycarbamate |
|---|---|
| PubChem CID | 118071965 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [1-(4-hydroxyphenyl)-2-phenylindol-3-yl] N-hydroxycarbamate |
| SMILES | O=C(NO)Oc1c(-c2ccccc2)n(-c2ccc(O)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H16N2O4/c24-16-12-10-15(11-13-16)23-18-9-5-4-8-17(18)20(27-21(25)22-26)19(23)14-6-2-1-3-7-14/h1-13,24,26H,(H,22,25) |
| InChIKey | ZHBQFSPSRBRYGR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|