C18H13NO3 — CID 142763531
1-(4-hydroxyphenyl)-2-prop-1-ynylindole-3-carboxylic acid (PubChem CID 142763531) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-2-prop-1-ynylindole-3-carboxylic acid.
| Compound Name | 1-(4-hydroxyphenyl)-2-prop-1-ynylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 142763531 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-(4-hydroxyphenyl)-2-prop-1-ynylindole-3-carboxylic acid |
| SMILES | CC#Cc1c(C(=O)O)c2ccccc2n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C18H13NO3/c1-2-5-16-17(18(21)22)14-6-3-4-7-15(14)19(16)12-8-10-13(20)11-9-12/h3-4,6-11,20H,1H3,(H,21,22) |
| InChIKey | YCJMYDOLZIYCKA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|