C9H6Cl2F3N — CID 11807271
4-chloro-N-(2,2,2-trifluoroethyl)benzenecarboximidoyl chloride (PubChem CID 11807271) has the molecular formula C9H6Cl2F3N and a molecular weight of 256.05 g/mol. Its IUPAC name is 4-chloro-N-(2,2,2-trifluoroethyl)benzenecarboximidoyl chloride.
| Compound Name | 4-chloro-N-(2,2,2-trifluoroethyl)benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 11807271 |
| Molecular Formula | C9H6Cl2F3N |
| Molecular Weight | 256.05 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 4-chloro-N-(2,2,2-trifluoroethyl)benzenecarboximidoyl chloride |
| SMILES | FC(F)(F)C/N=C(\Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6Cl2F3N/c10-7-3-1-6(2-4-7)8(11)15-5-9(12,13)14/h1-4H,5H2/b15-8- |
| InChIKey | ZJHQQCDVIVSDMQ-NVNXTCNLSA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.05 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|