C24H15NO5 — CID 118078114
5-[2-carboxy-6-[2-(3-hydroxyphenyl)ethynyl]phenyl]-1H-indole-2-carboxylic acid (PubChem CID 118078114) has the molecular formula C24H15NO5 and a molecular weight of 397.39 g/mol. Its IUPAC name is 5-[2-carboxy-6-[2-(3-hydroxyphenyl)ethynyl]phenyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[2-carboxy-6-[2-(3-hydroxyphenyl)ethynyl]phenyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 118078114 |
| Molecular Formula | C24H15NO5 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 5-[2-carboxy-6-[2-(3-hydroxyphenyl)ethynyl]phenyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(-c3c(C#Cc4cccc(O)c4)cccc3C(=O)O)ccc2[nH]1 |
| InChI | InChI=1S/C24H15NO5/c26-18-5-1-3-14(11-18)7-8-15-4-2-6-19(23(27)28)22(15)16-9-10-20-17(12-16)13-21(25-20)24(29)30/h1-6,9-13,25-26H,(H,27,28)(H,29,30) |
| InChIKey | LTSOASTVTSVPHA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|